C10H14ClFN2O2 — CID 70099503
2-[(2S)-2-amino-3-hydroxypropyl]-5-fluorobenzamide;hydrochloride (PubChem CID 70099503) has the molecular formula C10H14ClFN2O2 and a molecular weight of 248.69 g/mol. Its IUPAC name is 2-[(2S)-2-amino-3-hydroxypropyl]-5-fluorobenzamide;hydrochloride.
| Compound Name | 2-[(2S)-2-amino-3-hydroxypropyl]-5-fluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 70099503 |
| Molecular Formula | C10H14ClFN2O2 |
| Molecular Weight | 248.69 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 2-[(2S)-2-amino-3-hydroxypropyl]-5-fluorobenzamide;hydrochloride |
| SMILES | Cl.NC(=O)c1cc(F)ccc1C[C@H](N)CO |
| InChI | InChI=1S/C10H13FN2O2.ClH/c11-7-2-1-6(3-8(12)5-14)9(4-7)10(13)15;/h1-2,4,8,14H,3,5,12H2,(H2,13,15);1H/t8-;/m0./s1 |
| InChIKey | RYJQRXWJNFEGBA-QRPNPIFTSA-N |
| XLogP | 0.21 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.69 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |