C23H18F2N4OS — CID 70108043
N-[5-(2,2-diphenylethylamino)-1,3,4-thiadiazol-2-yl]-2,3-difluorobenzamide (PubChem CID 70108043) has the molecular formula C23H18F2N4OS and a molecular weight of 436.49 g/mol. Its IUPAC name is N-[5-(2,2-diphenylethylamino)-1,3,4-thiadiazol-2-yl]-2,3-difluorobenzamide.
| Compound Name | N-[5-(2,2-diphenylethylamino)-1,3,4-thiadiazol-2-yl]-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 70108043 |
| Molecular Formula | C23H18F2N4OS |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | N-[5-(2,2-diphenylethylamino)-1,3,4-thiadiazol-2-yl]-2,3-difluorobenzamide |
| SMILES | O=C(Nc1nnc(NCC(c2ccccc2)c2ccccc2)s1)c1cccc(F)c1F |
| InChI | InChI=1S/C23H18F2N4OS/c24-19-13-7-12-17(20(19)25)21(30)27-23-29-28-22(31-23)26-14-18(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-13,18H,14H2,(H,26,28)(H,27,29,30) |
| InChIKey | GRZBNUPFUIEZLN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |