C26H26ClN3O — CID 70109487
3-[[3-(aminomethyl)cyclohexyl]methyl]-6-chloro-2-naphthalen-1-ylquinazolin-4-one (PubChem CID 70109487) has the molecular formula C26H26ClN3O and a molecular weight of 431.97 g/mol. Its IUPAC name is 3-[[3-(aminomethyl)cyclohexyl]methyl]-6-chloro-2-naphthalen-1-ylquinazolin-4-one.
| Compound Name | 3-[[3-(aminomethyl)cyclohexyl]methyl]-6-chloro-2-naphthalen-1-ylquinazolin-4-one |
|---|---|
| PubChem CID | 70109487 |
| Molecular Formula | C26H26ClN3O |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 3-[[3-(aminomethyl)cyclohexyl]methyl]-6-chloro-2-naphthalen-1-ylquinazolin-4-one |
| SMILES | NCC1CCCC(Cn2c(-c3cccc4ccccc34)nc3ccc(Cl)cc3c2=O)C1 |
| InChI | InChI=1S/C26H26ClN3O/c27-20-11-12-24-23(14-20)26(31)30(16-18-6-3-5-17(13-18)15-28)25(29-24)22-10-4-8-19-7-1-2-9-21(19)22/h1-2,4,7-12,14,17-18H,3,5-6,13,15-16,28H2 |
| InChIKey | PAVNQPOLYXXNIQ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |