C23H26ClN3O — CID 22058167
3-[[3-(aminomethyl)cyclohexyl]methyl]-7-chloro-2-(4-methylphenyl)quinazolin-4-one (PubChem CID 22058167) has the molecular formula C23H26ClN3O and a molecular weight of 395.93 g/mol. Its IUPAC name is 3-[[3-(aminomethyl)cyclohexyl]methyl]-7-chloro-2-(4-methylphenyl)quinazolin-4-one.
| Compound Name | 3-[[3-(aminomethyl)cyclohexyl]methyl]-7-chloro-2-(4-methylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 22058167 |
| Molecular Formula | C23H26ClN3O |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 3-[[3-(aminomethyl)cyclohexyl]methyl]-7-chloro-2-(4-methylphenyl)quinazolin-4-one |
| SMILES | Cc1ccc(-c2nc3cc(Cl)ccc3c(=O)n2CC2CCCC(CN)C2)cc1 |
| InChI | InChI=1S/C23H26ClN3O/c1-15-5-7-18(8-6-15)22-26-21-12-19(24)9-10-20(21)23(28)27(22)14-17-4-2-3-16(11-17)13-25/h5-10,12,16-17H,2-4,11,13-14,25H2,1H3 |
| InChIKey | SCRNDSDHTNXUNL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |