C22H24ClN3O — CID 142655017
3-[[3-(aminomethyl)cyclohexyl]methyl]-2-(3-chlorophenyl)quinazolin-4-one (PubChem CID 142655017) has the molecular formula C22H24ClN3O and a molecular weight of 381.91 g/mol. Its IUPAC name is 3-[[3-(aminomethyl)cyclohexyl]methyl]-2-(3-chlorophenyl)quinazolin-4-one.
| Compound Name | 3-[[3-(aminomethyl)cyclohexyl]methyl]-2-(3-chlorophenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 142655017 |
| Molecular Formula | C22H24ClN3O |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 3-[[3-(aminomethyl)cyclohexyl]methyl]-2-(3-chlorophenyl)quinazolin-4-one |
| SMILES | NCC1CCCC(Cn2c(-c3cccc(Cl)c3)nc3ccccc3c2=O)C1 |
| InChI | InChI=1S/C22H24ClN3O/c23-18-8-4-7-17(12-18)21-25-20-10-2-1-9-19(20)22(27)26(21)14-16-6-3-5-15(11-16)13-24/h1-2,4,7-10,12,15-16H,3,5-6,11,13-14,24H2 |
| InChIKey | ULCITDKLFGCCSR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |