C22H30ClN3O — CID 22058157
3-[[3-(aminomethyl)cyclohexyl]methyl]-7-chloro-2-cyclohexylquinazolin-4-one (PubChem CID 22058157) has the molecular formula C22H30ClN3O and a molecular weight of 387.96 g/mol. Its IUPAC name is 3-[[3-(aminomethyl)cyclohexyl]methyl]-7-chloro-2-cyclohexylquinazolin-4-one.
| Compound Name | 3-[[3-(aminomethyl)cyclohexyl]methyl]-7-chloro-2-cyclohexylquinazolin-4-one |
|---|---|
| PubChem CID | 22058157 |
| Molecular Formula | C22H30ClN3O |
| Molecular Weight | 387.96 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 3-[[3-(aminomethyl)cyclohexyl]methyl]-7-chloro-2-cyclohexylquinazolin-4-one |
| SMILES | NCC1CCCC(Cn2c(C3CCCCC3)nc3cc(Cl)ccc3c2=O)C1 |
| InChI | InChI=1S/C22H30ClN3O/c23-18-9-10-19-20(12-18)25-21(17-7-2-1-3-8-17)26(22(19)27)14-16-6-4-5-15(11-16)13-24/h9-10,12,15-17H,1-8,11,13-14,24H2 |
| InChIKey | IOKHLGPWUNYPRK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.96 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |