C15H21N3O3 — CID 7011072
(5S)-1-cycloheptyl-5-(cyclopropyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7011072) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is (5S)-1-cycloheptyl-5-(cyclopropyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5S)-1-cycloheptyl-5-(cyclopropyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7011072 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (5S)-1-cycloheptyl-5-(cyclopropyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(C2CCCCCC2)C(=O)[C@H]1/C=N/C1CC1 |
| InChI | InChI=1S/C15H21N3O3/c19-13-12(9-16-10-7-8-10)14(20)18(15(21)17-13)11-5-3-1-2-4-6-11/h9-12H,1-8H2,(H,17,19,21)/b16-9+/t12-/m0/s1 |
| InChIKey | JSNNEBJVDBDESA-RGZVIEDOSA-N |
| XLogP | 1.64 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|