C15H25N3O3 — CID 7461422
1-tert-butyl-5-(hexyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7461422) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-tert-butyl-5-(hexyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-tert-butyl-5-(hexyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7461422 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 1-tert-butyl-5-(hexyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCCC/N=C/C1C(=O)NC(=O)N(C(C)(C)C)C1=O |
| InChI | InChI=1S/C15H25N3O3/c1-5-6-7-8-9-16-10-11-12(19)17-14(21)18(13(11)20)15(2,3)4/h10-11H,5-9H2,1-4H3,(H,17,19,21)/b16-10+ |
| InChIKey | YXDHCDCGDNNNIO-MHWRWJLKSA-N |
| XLogP | 2.13 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|