C11H16N3O3+ — CID 7059766
cyclohexyl-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylidene]azanium (PubChem CID 7059766) has the molecular formula C11H16N3O3+ and a molecular weight of 238.27 g/mol. Its IUPAC name is cyclohexyl-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylidene]azanium.
| Compound Name | cyclohexyl-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylidene]azanium |
|---|---|
| PubChem CID | 7059766 |
| Molecular Formula | C11H16N3O3+ |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | cyclohexyl-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylidene]azanium |
| SMILES | O=C1NC(=O)C(/C=[NH+]/C2CCCCC2)C(=O)N1 |
| InChI | InChI=1S/C11H15N3O3/c15-9-8(10(16)14-11(17)13-9)6-12-7-4-2-1-3-5-7/h6-8H,1-5H2,(H2,13,14,15,16,17)/p+1/b12-6+ |
| InChIKey | YACIATPBMBTLFT-WUXMJOGZSA-O |
| XLogP | -1.55 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|