C15H25N4O3+ — CID 7367975
2-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]ethyl-dimethylazanium (PubChem CID 7367975) has the molecular formula C15H25N4O3+ and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]ethyl-dimethylazanium.
| Compound Name | 2-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7367975 |
| Molecular Formula | C15H25N4O3+ |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 2-[(1-cyclohexyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CC/N=C/C1C(=O)NC(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C15H24N4O3/c1-18(2)9-8-16-10-12-13(20)17-15(22)19(14(12)21)11-6-4-3-5-7-11/h10-12H,3-9H2,1-2H3,(H,17,20,22)/p+1/b16-10+ |
| InChIKey | PPUCTTUHHZNEBW-MHWRWJLKSA-O |
| XLogP | -0.77 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|