C17H31N4O3+ — CID 7048853
[(4S)-4-[1-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)ethylideneamino]pentyl]-diethylazanium (PubChem CID 7048853) has the molecular formula C17H31N4O3+ and a molecular weight of 339.46 g/mol. Its IUPAC name is [(4S)-4-[1-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)ethylideneamino]pentyl]-diethylazanium.
| Compound Name | [(4S)-4-[1-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)ethylideneamino]pentyl]-diethylazanium |
|---|---|
| PubChem CID | 7048853 |
| Molecular Formula | C17H31N4O3+ |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | [(4S)-4-[1-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)ethylideneamino]pentyl]-diethylazanium |
| SMILES | CC[NH+](CC)CCC[C@H](C)/N=C(\C)C1C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C17H30N4O3/c1-7-21(8-2)11-9-10-12(3)18-13(4)14-15(22)19(5)17(24)20(6)16(14)23/h12,14H,7-11H2,1-6H3/p+1/b18-13+/t12-/m0/s1 |
| InChIKey | MJJWZZLDSZPOCV-DHPZXVACSA-O |
| XLogP | 0.21 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|