C16H29N4O3+ — CID 7282533
diethyl-[(4S)-4-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)propylideneamino]pentyl]azanium (PubChem CID 7282533) has the molecular formula C16H29N4O3+ and a molecular weight of 325.43 g/mol. Its IUPAC name is diethyl-[(4S)-4-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)propylideneamino]pentyl]azanium.
| Compound Name | diethyl-[(4S)-4-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)propylideneamino]pentyl]azanium |
|---|---|
| PubChem CID | 7282533 |
| Molecular Formula | C16H29N4O3+ |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | diethyl-[(4S)-4-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)propylideneamino]pentyl]azanium |
| SMILES | CC/C(=N\[C@@H](C)CCC[NH+](CC)CC)C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C16H28N4O3/c1-5-12(13-14(21)18-16(23)19-15(13)22)17-11(4)9-8-10-20(6-2)7-3/h11,13H,5-10H2,1-4H3,(H2,18,19,21,22,23)/p+1/b17-12+/t11-/m0/s1 |
| InChIKey | NXUOGEGNNYTPLI-GBTTUNCCSA-O |
| XLogP | -0.09 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|