C16H28N4O3 — CID 7282534
5-[N-[(2S)-5-(diethylamino)pentan-2-yl]-C-ethylcarbonimidoyl]-1,3-diazinane-2,4,6-trione (PubChem CID 7282534) has the molecular formula C16H28N4O3 and a molecular weight of 324.43 g/mol. Its IUPAC name is 5-[N-[(2S)-5-(diethylamino)pentan-2-yl]-C-ethylcarbonimidoyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[N-[(2S)-5-(diethylamino)pentan-2-yl]-C-ethylcarbonimidoyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7282534 |
| Molecular Formula | C16H28N4O3 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 5-[N-[(2S)-5-(diethylamino)pentan-2-yl]-C-ethylcarbonimidoyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CC/C(=N\[C@@H](C)CCCN(CC)CC)C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C16H28N4O3/c1-5-12(13-14(21)18-16(23)19-15(13)22)17-11(4)9-8-10-20(6-2)7-3/h11,13H,5-10H2,1-4H3,(H2,18,19,21,22,23)/b17-12+/t11-/m0/s1 |
| InChIKey | NXUOGEGNNYTPLI-GBTTUNCCSA-N |
| XLogP | 1.33 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|