C18H33N4O3+ — CID 7365685
[(4S)-4-[1-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)propylideneamino]pentyl]-diethylazanium (PubChem CID 7365685) has the molecular formula C18H33N4O3+ and a molecular weight of 353.49 g/mol. Its IUPAC name is [(4S)-4-[1-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)propylideneamino]pentyl]-diethylazanium.
| Compound Name | [(4S)-4-[1-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)propylideneamino]pentyl]-diethylazanium |
|---|---|
| PubChem CID | 7365685 |
| Molecular Formula | C18H33N4O3+ |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | [(4S)-4-[1-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)propylideneamino]pentyl]-diethylazanium |
| SMILES | CC/C(=N\[C@@H](C)CCC[NH+](CC)CC)C1C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C18H32N4O3/c1-7-14(19-13(4)11-10-12-22(8-2)9-3)15-16(23)20(5)18(25)21(6)17(15)24/h13,15H,7-12H2,1-6H3/p+1/b19-14+/t13-/m0/s1 |
| InChIKey | PVDFXKSRWQXPFR-AZDDOORDSA-O |
| XLogP | 0.60 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|