C17H30N4O3 — CID 7048854
5-[N-[(2S)-5-(diethylamino)pentan-2-yl]-C-methylcarbonimidoyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 7048854) has the molecular formula C17H30N4O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is 5-[N-[(2S)-5-(diethylamino)pentan-2-yl]-C-methylcarbonimidoyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[N-[(2S)-5-(diethylamino)pentan-2-yl]-C-methylcarbonimidoyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7048854 |
| Molecular Formula | C17H30N4O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | 5-[N-[(2S)-5-(diethylamino)pentan-2-yl]-C-methylcarbonimidoyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCN(CC)CCC[C@H](C)/N=C(\C)C1C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C17H30N4O3/c1-7-21(8-2)11-9-10-12(3)18-13(4)14-15(22)19(5)17(24)20(6)16(14)23/h12,14H,7-11H2,1-6H3/b18-13+/t12-/m0/s1 |
| InChIKey | MJJWZZLDSZPOCV-DHPZXVACSA-N |
| XLogP | 1.62 |
| TPSA | 73.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|