C24H38N3O3+ — CID 7307156
cycloheptyl-[(1,3-dicyclohexyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylidene]azanium (PubChem CID 7307156) has the molecular formula C24H38N3O3+ and a molecular weight of 416.59 g/mol. Its IUPAC name is cycloheptyl-[(1,3-dicyclohexyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylidene]azanium.
| Compound Name | cycloheptyl-[(1,3-dicyclohexyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylidene]azanium |
|---|---|
| PubChem CID | 7307156 |
| Molecular Formula | C24H38N3O3+ |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | cycloheptyl-[(1,3-dicyclohexyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylidene]azanium |
| SMILES | O=C1C(/C=[NH+]/C2CCCCCC2)C(=O)N(C2CCCCC2)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C24H37N3O3/c28-22-21(17-25-18-11-5-1-2-6-12-18)23(29)27(20-15-9-4-10-16-20)24(30)26(22)19-13-7-3-8-14-19/h17-21H,1-16H2/p+1/b25-17+ |
| InChIKey | PYCGRQWOMHWNBG-KOEQRZSOSA-O |
| XLogP | 2.93 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|