C21H33N3O3 — CID 7048927
1,3-dicyclohexyl-5-(2-methylpropyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7048927) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is 1,3-dicyclohexyl-5-(2-methylpropyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dicyclohexyl-5-(2-methylpropyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7048927 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | 1,3-dicyclohexyl-5-(2-methylpropyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CC(C)C/N=C/C1C(=O)N(C2CCCCC2)C(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C21H33N3O3/c1-15(2)13-22-14-18-19(25)23(16-9-5-3-6-10-16)21(27)24(20(18)26)17-11-7-4-8-12-17/h14-18H,3-13H2,1-2H3/b22-14+ |
| InChIKey | ZRYZVIVUWZMWFS-HYARGMPZSA-N |
| XLogP | 3.79 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|