C22H35N3O3 — CID 7048924
1,3-dicyclohexyl-5-(pentyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7048924) has the molecular formula C22H35N3O3 and a molecular weight of 389.54 g/mol. Its IUPAC name is 1,3-dicyclohexyl-5-(pentyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dicyclohexyl-5-(pentyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7048924 |
| Molecular Formula | C22H35N3O3 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | 1,3-dicyclohexyl-5-(pentyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCC/N=C/C1C(=O)N(C2CCCCC2)C(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C22H35N3O3/c1-2-3-10-15-23-16-19-20(26)24(17-11-6-4-7-12-17)22(28)25(21(19)27)18-13-8-5-9-14-18/h16-19H,2-15H2,1H3/b23-16+ |
| InChIKey | TVTCBIHAOWRVNA-XQNSMLJCSA-N |
| XLogP | 4.32 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|