C23H39N5O3+2 — CID 7285083
1,3-dicyclohexyl-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7285083) has the molecular formula C23H39N5O3+2 and a molecular weight of 433.60 g/mol. Its IUPAC name is 1,3-dicyclohexyl-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dicyclohexyl-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7285083 |
| Molecular Formula | C23H39N5O3+2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.30 |
| IUPAC Name | 1,3-dicyclohexyl-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1C(/C=N/CC[NH+]2CC[NH2+]CC2)C(=O)N(C2CCCCC2)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C23H37N5O3/c29-21-20(17-25-13-16-26-14-11-24-12-15-26)22(30)28(19-9-5-2-6-10-19)23(31)27(21)18-7-3-1-4-8-18/h17-20,24H,1-16H2/p+2/b25-17+ |
| InChIKey | FQTBVOUKKGLOAV-KOEQRZSOSA-P |
| XLogP | -0.41 |
| TPSA | 91.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|