C34H36F2O10 — CID 70113788
(2R,3S,4S,5S)-2,5-bis[(3,4-dihydroxyphenyl)methoxy]-7-(4-fluorophenyl)-6-[(4-fluorophenyl)methoxy]heptane-1,3,4-triol (PubChem CID 70113788) has the molecular formula C34H36F2O10 and a molecular weight of 642.65 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2,5-bis[(3,4-dihydroxyphenyl)methoxy]-7-(4-fluorophenyl)-6-[(4-fluorophenyl)methoxy]heptane-1,3,4-triol.
| Compound Name | (2R,3S,4S,5S)-2,5-bis[(3,4-dihydroxyphenyl)methoxy]-7-(4-fluorophenyl)-6-[(4-fluorophenyl)methoxy]heptane-1,3,4-triol |
|---|---|
| PubChem CID | 70113788 |
| Molecular Formula | C34H36F2O10 |
| Molecular Weight | 642.65 g/mol |
| Exact Mass | 642.23 |
| IUPAC Name | (2R,3S,4S,5S)-2,5-bis[(3,4-dihydroxyphenyl)methoxy]-7-(4-fluorophenyl)-6-[(4-fluorophenyl)methoxy]heptane-1,3,4-triol |
| SMILES | OC[C@@H](OCc1ccc(O)c(O)c1)[C@@H](O)C(O)[C@H](OCc1ccc(O)c(O)c1)C(Cc1ccc(F)cc1)OCc1ccc(F)cc1 |
| InChI | InChI=1S/C34H36F2O10/c35-24-7-1-20(2-8-24)15-30(44-17-21-3-9-25(36)10-4-21)34(46-19-23-6-12-27(39)29(41)14-23)33(43)32(42)31(16-37)45-18-22-5-11-26(38)28(40)13-22/h1-14,30-34,37-43H,15-19H2/t30?,31-,32-,33?,34-/m1/s1 |
| InChIKey | SEAAOWLLBDSYQL-DGOCCOPWSA-N |
| XLogP | 3.80 |
| TPSA | 169.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.65 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|