C34H36F2O10 — CID 54120288
4-[[(2R,3S,4S,5R)-6-[(3,4-dihydroxyphenyl)methoxy]-2,5-bis[(4-fluorophenyl)methoxy]-3,4-dihydroxyhexoxy]methyl]benzene-1,2-diol (PubChem CID 54120288) has the molecular formula C34H36F2O10 and a molecular weight of 642.65 g/mol. Its IUPAC name is 4-[[(2R,3S,4S,5R)-6-[(3,4-dihydroxyphenyl)methoxy]-2,5-bis[(4-fluorophenyl)methoxy]-3,4-dihydroxyhexoxy]methyl]benzene-1,2-diol.
| Compound Name | 4-[[(2R,3S,4S,5R)-6-[(3,4-dihydroxyphenyl)methoxy]-2,5-bis[(4-fluorophenyl)methoxy]-3,4-dihydroxyhexoxy]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 54120288 |
| Molecular Formula | C34H36F2O10 |
| Molecular Weight | 642.65 g/mol |
| Exact Mass | 642.23 |
| IUPAC Name | 4-[[(2R,3S,4S,5R)-6-[(3,4-dihydroxyphenyl)methoxy]-2,5-bis[(4-fluorophenyl)methoxy]-3,4-dihydroxyhexoxy]methyl]benzene-1,2-diol |
| SMILES | Oc1ccc(COC[C@@H](OCc2ccc(F)cc2)[C@@H](O)[C@H](O)[C@@H](COCc2ccc(O)c(O)c2)OCc2ccc(F)cc2)cc1O |
| InChI | InChI=1S/C34H36F2O10/c35-25-7-1-21(2-8-25)17-45-31(19-43-15-23-5-11-27(37)29(39)13-23)33(41)34(42)32(46-18-22-3-9-26(36)10-4-22)20-44-16-24-6-12-28(38)30(40)14-24/h1-14,31-34,37-42H,15-20H2/t31-,32-,33-,34-/m1/s1 |
| InChIKey | NNFCOSXHHJTVOQ-YFRBGRBWSA-N |
| XLogP | 4.41 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.65 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|