C24H25FO5 — CID 70428683
2-fluoro-3-[3-hydroxy-1,4-bis(phenylmethoxy)butan-2-yl]oxyphenol (PubChem CID 70428683) has the molecular formula C24H25FO5 and a molecular weight of 412.46 g/mol. Its IUPAC name is 2-fluoro-3-[3-hydroxy-1,4-bis(phenylmethoxy)butan-2-yl]oxyphenol.
| Compound Name | 2-fluoro-3-[3-hydroxy-1,4-bis(phenylmethoxy)butan-2-yl]oxyphenol |
|---|---|
| PubChem CID | 70428683 |
| Molecular Formula | C24H25FO5 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 2-fluoro-3-[3-hydroxy-1,4-bis(phenylmethoxy)butan-2-yl]oxyphenol |
| SMILES | Oc1cccc(OC(COCc2ccccc2)C(O)COCc2ccccc2)c1F |
| InChI | InChI=1S/C24H25FO5/c25-24-20(26)12-7-13-22(24)30-23(17-29-15-19-10-5-2-6-11-19)21(27)16-28-14-18-8-3-1-4-9-18/h1-13,21,23,26-27H,14-17H2 |
| InChIKey | NACJMZUZVZXYJJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |