C24H26O5 — CID 10644340
2-[(2R,3S)-3-hydroxy-1,4-bis(phenylmethoxy)butan-2-yl]oxyphenol (PubChem CID 10644340) has the molecular formula C24H26O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is 2-[(2R,3S)-3-hydroxy-1,4-bis(phenylmethoxy)butan-2-yl]oxyphenol.
| Compound Name | 2-[(2R,3S)-3-hydroxy-1,4-bis(phenylmethoxy)butan-2-yl]oxyphenol |
|---|---|
| PubChem CID | 10644340 |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 2-[(2R,3S)-3-hydroxy-1,4-bis(phenylmethoxy)butan-2-yl]oxyphenol |
| SMILES | Oc1ccccc1O[C@H](COCc1ccccc1)[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C24H26O5/c25-21-13-7-8-14-23(21)29-24(18-28-16-20-11-5-2-6-12-20)22(26)17-27-15-19-9-3-1-4-10-19/h1-14,22,24-26H,15-18H2/t22-,24+/m0/s1 |
| InChIKey | KCPSXTVTCZAIEG-LADGPHEKSA-N |
| XLogP | 3.93 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |