C21H28O5 — CID 121493935
(2R,3S)-3-(3-hydroxypropoxy)-1,4-bis(phenylmethoxy)butan-2-ol (PubChem CID 121493935) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is (2R,3S)-3-(3-hydroxypropoxy)-1,4-bis(phenylmethoxy)butan-2-ol.
| Compound Name | (2R,3S)-3-(3-hydroxypropoxy)-1,4-bis(phenylmethoxy)butan-2-ol |
|---|---|
| PubChem CID | 121493935 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (2R,3S)-3-(3-hydroxypropoxy)-1,4-bis(phenylmethoxy)butan-2-ol |
| SMILES | OCCCO[C@@H](COCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C21H28O5/c22-12-7-13-26-21(17-25-15-19-10-5-2-6-11-19)20(23)16-24-14-18-8-3-1-4-9-18/h1-6,8-11,20-23H,7,12-17H2/t20-,21+/m1/s1 |
| InChIKey | JHHFJJABQIFOSH-RTWAWAEBSA-N |
| XLogP | 2.55 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|