C34H35F3O7 — CID 70095900
(2R,3S,4S,5S)-7-(2-fluorophenyl)-6-[(2-fluorophenyl)methoxy]-5-[(4-fluorophenyl)methoxy]-2-[(4-hydroxyphenyl)methoxy]heptane-1,3,4-triol (PubChem CID 70095900) has the molecular formula C34H35F3O7 and a molecular weight of 612.64 g/mol. Its IUPAC name is (2R,3S,4S,5S)-7-(2-fluorophenyl)-6-[(2-fluorophenyl)methoxy]-5-[(4-fluorophenyl)methoxy]-2-[(4-hydroxyphenyl)methoxy]heptane-1,3,4-triol.
| Compound Name | (2R,3S,4S,5S)-7-(2-fluorophenyl)-6-[(2-fluorophenyl)methoxy]-5-[(4-fluorophenyl)methoxy]-2-[(4-hydroxyphenyl)methoxy]heptane-1,3,4-triol |
|---|---|
| PubChem CID | 70095900 |
| Molecular Formula | C34H35F3O7 |
| Molecular Weight | 612.64 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | (2R,3S,4S,5S)-7-(2-fluorophenyl)-6-[(2-fluorophenyl)methoxy]-5-[(4-fluorophenyl)methoxy]-2-[(4-hydroxyphenyl)methoxy]heptane-1,3,4-triol |
| SMILES | OC[C@@H](OCc1ccc(O)cc1)[C@@H](O)[C@H](O)[C@H](OCc1ccc(F)cc1)C(Cc1ccccc1F)OCc1ccccc1F |
| InChI | InChI=1S/C34H35F3O7/c35-26-13-9-22(10-14-26)20-44-34(33(41)32(40)31(18-38)42-19-23-11-15-27(39)16-12-23)30(17-24-5-1-3-7-28(24)36)43-21-25-6-2-4-8-29(25)37/h1-16,30-34,38-41H,17-21H2/t30?,31-,32-,33+,34-/m1/s1 |
| InChIKey | LFOCKVBGGQUEOA-ROPPFYJWSA-N |
| XLogP | 4.82 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.64 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |