C37H43N3O — CID 70118248
(6aR,9S,10aR)-9-[2-(3-benzhydryloxy-8-azabicyclo[3.2.1]octan-8-yl)ethyl]-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline (PubChem CID 70118248) has the molecular formula C37H43N3O and a molecular weight of 545.77 g/mol. Its IUPAC name is (6aR,9S,10aR)-9-[2-(3-benzhydryloxy-8-azabicyclo[3.2.1]octan-8-yl)ethyl]-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline.
| Compound Name | (6aR,9S,10aR)-9-[2-(3-benzhydryloxy-8-azabicyclo[3.2.1]octan-8-yl)ethyl]-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 70118248 |
| Molecular Formula | C37H43N3O |
| Molecular Weight | 545.77 g/mol |
| Exact Mass | 545.34 |
| IUPAC Name | (6aR,9S,10aR)-9-[2-(3-benzhydryloxy-8-azabicyclo[3.2.1]octan-8-yl)ethyl]-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
| SMILES | CN1C[C@H](CCN2C3CCC2CC(OC(c2ccccc2)c2ccccc2)C3)C[C@@H]2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C37H43N3O/c1-39-24-25(19-33-32-13-8-14-34-36(32)28(23-38-34)20-35(33)39)17-18-40-29-15-16-30(40)22-31(21-29)41-37(26-9-4-2-5-10-26)27-11-6-3-7-12-27/h2-14,23,25,29-31,33,35,37-38H,15-22,24H2,1H3/t25-,29?,30?,31?,33-,35-/m1/s1 |
| InChIKey | HHUYFIXNNCSMQB-BUKHYWNESA-N |
| XLogP | 7.32 |
| TPSA | 31.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.77 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |