C25H39N5O3 — CID 70119528
2-[4-[[3-[4-[(4-propylpiperazin-1-yl)iminomethyl]phenyl]-1,2-oxazolidin-5-yl]methyl]piperidin-1-yl]acetic acid (PubChem CID 70119528) has the molecular formula C25H39N5O3 and a molecular weight of 457.62 g/mol. Its IUPAC name is 2-[4-[[3-[4-[(4-propylpiperazin-1-yl)iminomethyl]phenyl]-1,2-oxazolidin-5-yl]methyl]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[[3-[4-[(4-propylpiperazin-1-yl)iminomethyl]phenyl]-1,2-oxazolidin-5-yl]methyl]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 70119528 |
| Molecular Formula | C25H39N5O3 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.31 |
| IUPAC Name | 2-[4-[[3-[4-[(4-propylpiperazin-1-yl)iminomethyl]phenyl]-1,2-oxazolidin-5-yl]methyl]piperidin-1-yl]acetic acid |
| SMILES | CCCN1CCN(N=Cc2ccc(C3CC(CC4CCN(CC(=O)O)CC4)ON3)cc2)CC1 |
| InChI | InChI=1S/C25H39N5O3/c1-2-9-28-12-14-30(15-13-28)26-18-21-3-5-22(6-4-21)24-17-23(33-27-24)16-20-7-10-29(11-8-20)19-25(31)32/h3-6,18,20,23-24,27H,2,7-17,19H2,1H3,(H,31,32) |
| InChIKey | ISBNDSHDUZGMGC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|