C26H32N4O3 — CID 90883817
2-[4-[[3-[4-[(2-phenylethyldiazenyl)methyl]phenyl]-1,2-oxazolidin-5-yl]methyl]-3,6-dihydro-2H-pyridin-1-yl]acetic acid (PubChem CID 90883817) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is 2-[4-[[3-[4-[(2-phenylethyldiazenyl)methyl]phenyl]-1,2-oxazolidin-5-yl]methyl]-3,6-dihydro-2H-pyridin-1-yl]acetic acid.
| Compound Name | 2-[4-[[3-[4-[(2-phenylethyldiazenyl)methyl]phenyl]-1,2-oxazolidin-5-yl]methyl]-3,6-dihydro-2H-pyridin-1-yl]acetic acid |
|---|---|
| PubChem CID | 90883817 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 2-[4-[[3-[4-[(2-phenylethyldiazenyl)methyl]phenyl]-1,2-oxazolidin-5-yl]methyl]-3,6-dihydro-2H-pyridin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CC=C(CC2CC(c3ccc(C/N=N/CCc4ccccc4)cc3)NO2)CC1 |
| InChI | InChI=1S/C26H32N4O3/c31-26(32)19-30-14-11-21(12-15-30)16-24-17-25(29-33-24)23-8-6-22(7-9-23)18-28-27-13-10-20-4-2-1-3-5-20/h1-9,11,24-25,29H,10,12-19H2,(H,31,32)/b28-27+ |
| InChIKey | LOFFQTQSZOPIRX-BYYHNAKLSA-N |
| XLogP | 4.32 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|