C21H32N4O3 — CID 90907597
2-[4-[[3-[4-[(propyldiazenyl)methyl]phenyl]-1,2-oxazolidin-5-yl]methyl]piperidin-1-yl]acetic acid (PubChem CID 90907597) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-[4-[[3-[4-[(propyldiazenyl)methyl]phenyl]-1,2-oxazolidin-5-yl]methyl]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[[3-[4-[(propyldiazenyl)methyl]phenyl]-1,2-oxazolidin-5-yl]methyl]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 90907597 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 2-[4-[[3-[4-[(propyldiazenyl)methyl]phenyl]-1,2-oxazolidin-5-yl]methyl]piperidin-1-yl]acetic acid |
| SMILES | CCC/N=N/Cc1ccc(C2CC(CC3CCN(CC(=O)O)CC3)ON2)cc1 |
| InChI | InChI=1S/C21H32N4O3/c1-2-9-22-23-14-17-3-5-18(6-4-17)20-13-19(28-24-20)12-16-7-10-25(11-8-16)15-21(26)27/h3-6,16,19-20,24H,2,7-15H2,1H3,(H,26,27)/b23-22+ |
| InChIKey | HJXZIIORMGWPBV-GHVJWSGMSA-N |
| XLogP | 3.57 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|