C23H35N5O3 — CID 70120914
2-[4-[[3-[4-[(4-methylpiperazin-1-yl)iminomethyl]phenyl]-1,2-oxazolidin-5-yl]methyl]piperidin-1-yl]acetic acid (PubChem CID 70120914) has the molecular formula C23H35N5O3 and a molecular weight of 429.57 g/mol. Its IUPAC name is 2-[4-[[3-[4-[(4-methylpiperazin-1-yl)iminomethyl]phenyl]-1,2-oxazolidin-5-yl]methyl]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[[3-[4-[(4-methylpiperazin-1-yl)iminomethyl]phenyl]-1,2-oxazolidin-5-yl]methyl]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 70120914 |
| Molecular Formula | C23H35N5O3 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | 2-[4-[[3-[4-[(4-methylpiperazin-1-yl)iminomethyl]phenyl]-1,2-oxazolidin-5-yl]methyl]piperidin-1-yl]acetic acid |
| SMILES | CN1CCN(N=Cc2ccc(C3CC(CC4CCN(CC(=O)O)CC4)ON3)cc2)CC1 |
| InChI | InChI=1S/C23H35N5O3/c1-26-10-12-28(13-11-26)24-16-19-2-4-20(5-3-19)22-15-21(31-25-22)14-18-6-8-27(9-7-18)17-23(29)30/h2-5,16,18,21-22,25H,6-15,17H2,1H3,(H,29,30) |
| InChIKey | CMXBJXBKRNJIMU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|