C21H19NO8 — CID 70120503
dimethyl 2-[1-(1,3-benzodioxol-5-yl)-3-(3-nitrophenyl)prop-2-enyl]propanedioate (PubChem CID 70120503) has the molecular formula C21H19NO8 and a molecular weight of 413.38 g/mol. Its IUPAC name is dimethyl 2-[1-(1,3-benzodioxol-5-yl)-3-(3-nitrophenyl)prop-2-enyl]propanedioate.
| Compound Name | dimethyl 2-[1-(1,3-benzodioxol-5-yl)-3-(3-nitrophenyl)prop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 70120503 |
| Molecular Formula | C21H19NO8 |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | dimethyl 2-[1-(1,3-benzodioxol-5-yl)-3-(3-nitrophenyl)prop-2-enyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)C(C=Cc1cccc([N+](=O)[O-])c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H19NO8/c1-27-20(23)19(21(24)28-2)16(14-7-9-17-18(11-14)30-12-29-17)8-6-13-4-3-5-15(10-13)22(25)26/h3-11,16,19H,12H2,1-2H3 |
| InChIKey | DYGZKZXBGRSMKY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|