C17H16N2O2 — CID 70121226
9-methoxy-7,8,11,12-tetrahydro-5H-indolo[3,2-c][1]benzazepin-6-one (PubChem CID 70121226) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 9-methoxy-7,8,11,12-tetrahydro-5H-indolo[3,2-c][1]benzazepin-6-one.
| Compound Name | 9-methoxy-7,8,11,12-tetrahydro-5H-indolo[3,2-c][1]benzazepin-6-one |
|---|---|
| PubChem CID | 70121226 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 9-methoxy-7,8,11,12-tetrahydro-5H-indolo[3,2-c][1]benzazepin-6-one |
| SMILES | COC1=CC2=C(CC1)C(=O)c1[nH]c3ccccc3c1CN2 |
| InChI | InChI=1S/C17H16N2O2/c1-21-10-6-7-12-15(8-10)18-9-13-11-4-2-3-5-14(11)19-16(13)17(12)20/h2-5,8,18-19H,6-7,9H2,1H3 |
| InChIKey | QDFMEFGTWIQKEH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|