C6H5NO2 — CID 70121327
3-methyl-3-azabicyclo[3.1.0]hex-1(6)-ene-2,4-dione (PubChem CID 70121327) has the molecular formula C6H5NO2 and a molecular weight of 123.11 g/mol. Its IUPAC name is 3-methyl-3-azabicyclo[3.1.0]hex-1(6)-ene-2,4-dione.
| Compound Name | 3-methyl-3-azabicyclo[3.1.0]hex-1(6)-ene-2,4-dione |
|---|---|
| PubChem CID | 70121327 |
| Molecular Formula | C6H5NO2 |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.03 |
| IUPAC Name | 3-methyl-3-azabicyclo[3.1.0]hex-1(6)-ene-2,4-dione |
| SMILES | CN1C(=O)C2=CC2C1=O |
| InChI | InChI=1S/C6H5NO2/c1-7-5(8)3-2-4(3)6(7)9/h2-3H,1H3 |
| InChIKey | GSGMLUPZORSBNS-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.11 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|