C40H48N2O6 — CID 70122807
benzyl (2S)-1-[(3S)-3-[[1-(2-butoxy-2-oxoethyl)cyclopentanecarbonyl]amino]-4-(4-phenylphenyl)butanoyl]pyrrolidine-2-carboxylate (PubChem CID 70122807) has the molecular formula C40H48N2O6 and a molecular weight of 652.83 g/mol. Its IUPAC name is benzyl (2S)-1-[(3S)-3-[[1-(2-butoxy-2-oxoethyl)cyclopentanecarbonyl]amino]-4-(4-phenylphenyl)butanoyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-[(3S)-3-[[1-(2-butoxy-2-oxoethyl)cyclopentanecarbonyl]amino]-4-(4-phenylphenyl)butanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 70122807 |
| Molecular Formula | C40H48N2O6 |
| Molecular Weight | 652.83 g/mol |
| Exact Mass | 652.35 |
| IUPAC Name | benzyl (2S)-1-[(3S)-3-[[1-(2-butoxy-2-oxoethyl)cyclopentanecarbonyl]amino]-4-(4-phenylphenyl)butanoyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCOC(=O)CC1(C(=O)N[C@H](CC(=O)N2CCC[C@H]2C(=O)OCc2ccccc2)Cc2ccc(-c3ccccc3)cc2)CCCC1 |
| InChI | InChI=1S/C40H48N2O6/c1-2-3-25-47-37(44)28-40(22-10-11-23-40)39(46)41-34(26-30-18-20-33(21-19-30)32-15-8-5-9-16-32)27-36(43)42-24-12-17-35(42)38(45)48-29-31-13-6-4-7-14-31/h4-9,13-16,18-21,34-35H,2-3,10-12,17,22-29H2,1H3,(H,41,46)/t34-,35-/m0/s1 |
| InChIKey | LVOXYFKDHXYALW-PXLJZGITSA-N |
| XLogP | 6.80 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.83 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|