C23H32N2O5 — CID 91337893
benzyl (2S)-1-[2-[1-(ethoxycarbonylamino)cyclohexyl]acetyl]pyrrolidine-2-carboxylate (PubChem CID 91337893) has the molecular formula C23H32N2O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is benzyl (2S)-1-[2-[1-(ethoxycarbonylamino)cyclohexyl]acetyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-[2-[1-(ethoxycarbonylamino)cyclohexyl]acetyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 91337893 |
| Molecular Formula | C23H32N2O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | benzyl (2S)-1-[2-[1-(ethoxycarbonylamino)cyclohexyl]acetyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)NC1(CC(=O)N2CCC[C@H]2C(=O)OCc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C23H32N2O5/c1-2-29-22(28)24-23(13-7-4-8-14-23)16-20(26)25-15-9-12-19(25)21(27)30-17-18-10-5-3-6-11-18/h3,5-6,10-11,19H,2,4,7-9,12-17H2,1H3,(H,24,28)/t19-/m0/s1 |
| InChIKey | VMIIDOCJTBBVTJ-IBGZPJMESA-N |
| XLogP | 3.56 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |