C24H40N4O4 — CID 70125241
(1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid;2-amino-N-(2-hydrazinyl-2-oxoethyl)acetamide (PubChem CID 70125241) has the molecular formula C24H40N4O4 and a molecular weight of 448.61 g/mol. Its IUPAC name is (1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid;2-amino-N-(2-hydrazinyl-2-oxoethyl)acetamide.
| Compound Name | (1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid;2-amino-N-(2-hydrazinyl-2-oxoethyl)acetamide |
|---|---|
| PubChem CID | 70125241 |
| Molecular Formula | C24H40N4O4 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | (1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid;2-amino-N-(2-hydrazinyl-2-oxoethyl)acetamide |
| SMILES | CC(C)C1=CC2=CC[C@@H]3[C@](C)(CCC[C@@]3(C)C(=O)O)[C@H]2CC1.NCC(=O)NCC(=O)NN |
| InChI | InChI=1S/C20H30O2.C4H10N4O2/c1-13(2)14-6-8-16-15(12-14)7-9-17-19(16,3)10-5-11-20(17,4)18(21)22;5-1-3(9)7-2-4(10)8-6/h7,12-13,16-17H,5-6,8-11H2,1-4H3,(H,21,22);1-2,5-6H2,(H,7,9)(H,8,10)/t16-,17+,19+,20+;/m0./s1 |
| InChIKey | GHYJZNVQCPNKAA-XTICBAGASA-N |
| XLogP | 2.26 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|