C26H27FN2 — CID 70128519
2-[4-[4-(6-fluorohept-1-enyl)phenyl]phenyl]-5-prop-2-enylpyrimidine (PubChem CID 70128519) has the molecular formula C26H27FN2 and a molecular weight of 386.51 g/mol. Its IUPAC name is 2-[4-[4-(6-fluorohept-1-enyl)phenyl]phenyl]-5-prop-2-enylpyrimidine.
| Compound Name | 2-[4-[4-(6-fluorohept-1-enyl)phenyl]phenyl]-5-prop-2-enylpyrimidine |
|---|---|
| PubChem CID | 70128519 |
| Molecular Formula | C26H27FN2 |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 2-[4-[4-(6-fluorohept-1-enyl)phenyl]phenyl]-5-prop-2-enylpyrimidine |
| SMILES | C=CCc1cnc(-c2ccc(-c3ccc(C=CCCCC(C)F)cc3)cc2)nc1 |
| InChI | InChI=1S/C26H27FN2/c1-3-7-22-18-28-26(29-19-22)25-16-14-24(15-17-25)23-12-10-21(11-13-23)9-6-4-5-8-20(2)27/h3,6,9-20H,1,4-5,7-8H2,2H3 |
| InChIKey | SHWNNUNAHXQCIN-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|