C24H28Br2O5 — CID 70132715
2-[3,5-dibromo-4-[2-(1-hydroxyhexyl)-4-methoxy-5-prop-2-enylphenoxy]phenyl]acetic acid (PubChem CID 70132715) has the molecular formula C24H28Br2O5 and a molecular weight of 556.29 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-[2-(1-hydroxyhexyl)-4-methoxy-5-prop-2-enylphenoxy]phenyl]acetic acid.
| Compound Name | 2-[3,5-dibromo-4-[2-(1-hydroxyhexyl)-4-methoxy-5-prop-2-enylphenoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 70132715 |
| Molecular Formula | C24H28Br2O5 |
| Molecular Weight | 556.29 g/mol |
| Exact Mass | 554.03 |
| IUPAC Name | 2-[3,5-dibromo-4-[2-(1-hydroxyhexyl)-4-methoxy-5-prop-2-enylphenoxy]phenyl]acetic acid |
| SMILES | C=CCc1cc(Oc2c(Br)cc(CC(=O)O)cc2Br)c(C(O)CCCCC)cc1OC |
| InChI | InChI=1S/C24H28Br2O5/c1-4-6-7-9-20(27)17-14-21(30-3)16(8-5-2)13-22(17)31-24-18(25)10-15(11-19(24)26)12-23(28)29/h5,10-11,13-14,20,27H,2,4,6-9,12H2,1,3H3,(H,28,29) |
| InChIKey | MMFSYWIDIPHUHD-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.29 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|