C23H19ClN2O2 — CID 7013554
(6R,6aS,9S)-6-(4-chlorophenyl)-9-(furan-2-yl)-5,6,6a,8,9,10-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 7013554) has the molecular formula C23H19ClN2O2 and a molecular weight of 390.87 g/mol. Its IUPAC name is (6R,6aS,9S)-6-(4-chlorophenyl)-9-(furan-2-yl)-5,6,6a,8,9,10-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R,6aS,9S)-6-(4-chlorophenyl)-9-(furan-2-yl)-5,6,6a,8,9,10-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 7013554 |
| Molecular Formula | C23H19ClN2O2 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (6R,6aS,9S)-6-(4-chlorophenyl)-9-(furan-2-yl)-5,6,6a,8,9,10-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | O=C1C[C@@H](c2ccco2)CC2=Nc3ccccc3N[C@@H](c3ccc(Cl)cc3)[C@H]12 |
| InChI | InChI=1S/C23H19ClN2O2/c24-16-9-7-14(8-10-16)23-22-19(25-17-4-1-2-5-18(17)26-23)12-15(13-20(22)27)21-6-3-11-28-21/h1-11,15,22-23,26H,12-13H2/t15-,22-,23-/m0/s1 |
| InChIKey | JDVGBIGVWKTJQO-MPMWTEJESA-N |
| XLogP | 5.94 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |