C27H26N2O — CID 7460799
(6R,9R)-6,9-bis(4-methylphenyl)-5,6,6a,8,9,10-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 7460799) has the molecular formula C27H26N2O and a molecular weight of 394.52 g/mol. Its IUPAC name is (6R,9R)-6,9-bis(4-methylphenyl)-5,6,6a,8,9,10-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6R,9R)-6,9-bis(4-methylphenyl)-5,6,6a,8,9,10-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 7460799 |
| Molecular Formula | C27H26N2O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (6R,9R)-6,9-bis(4-methylphenyl)-5,6,6a,8,9,10-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | Cc1ccc([C@H]2CC(=O)C3C(=Nc4ccccc4N[C@H]3c3ccc(C)cc3)C2)cc1 |
| InChI | InChI=1S/C27H26N2O/c1-17-7-11-19(12-8-17)21-15-24-26(25(30)16-21)27(20-13-9-18(2)10-14-20)29-23-6-4-3-5-22(23)28-24/h3-14,21,26-27,29H,15-16H2,1-2H3/t21-,26?,27+/m1/s1 |
| InChIKey | MJUQHUZTEQTLLR-KWKDFTITSA-N |
| XLogP | 6.31 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |