C15H13BrF4O2 — CID 70136608
(3Z)-3-[(3-bromo-4-fluorophenyl)methylidene]-1,1,1-trifluoro-5,5-dimethylhexane-2,4-dione (PubChem CID 70136608) has the molecular formula C15H13BrF4O2 and a molecular weight of 381.16 g/mol. Its IUPAC name is (3Z)-3-[(3-bromo-4-fluorophenyl)methylidene]-1,1,1-trifluoro-5,5-dimethylhexane-2,4-dione.
| Compound Name | (3Z)-3-[(3-bromo-4-fluorophenyl)methylidene]-1,1,1-trifluoro-5,5-dimethylhexane-2,4-dione |
|---|---|
| PubChem CID | 70136608 |
| Molecular Formula | C15H13BrF4O2 |
| Molecular Weight | 381.16 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | (3Z)-3-[(3-bromo-4-fluorophenyl)methylidene]-1,1,1-trifluoro-5,5-dimethylhexane-2,4-dione |
| SMILES | CC(C)(C)C(=O)/C(=C/c1ccc(F)c(Br)c1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C15H13BrF4O2/c1-14(2,3)12(21)9(13(22)15(18,19)20)6-8-4-5-11(17)10(16)7-8/h4-7H,1-3H3/b9-6- |
| InChIKey | AKWNSUUAKPYXCW-TWGQIWQCSA-N |
| XLogP | 4.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.16 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|