C20H22N2O5 — CID 70139370
3-[benzyl(butanoyl)amino]-4-(2-nitroethyl)benzoic acid (PubChem CID 70139370) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 3-[benzyl(butanoyl)amino]-4-(2-nitroethyl)benzoic acid.
| Compound Name | 3-[benzyl(butanoyl)amino]-4-(2-nitroethyl)benzoic acid |
|---|---|
| PubChem CID | 70139370 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 3-[benzyl(butanoyl)amino]-4-(2-nitroethyl)benzoic acid |
| SMILES | CCCC(=O)N(Cc1ccccc1)c1cc(C(=O)O)ccc1CC[N+](=O)[O-] |
| InChI | InChI=1S/C20H22N2O5/c1-2-6-19(23)21(14-15-7-4-3-5-8-15)18-13-17(20(24)25)10-9-16(18)11-12-22(26)27/h3-5,7-10,13H,2,6,11-12,14H2,1H3,(H,24,25) |
| InChIKey | IVSZWNQTSLFJNA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|