About (3R)-1-[3-(6H-benzo[c][1,5]benzodithiepin-6-yl)propyl]piperidine-3-carboxylic acid
(3R)-1-[3-(6H-benzo[c][1,5]benzodithiepin-6-yl)propyl]piperidine-3-carboxylic acid (PubChem CID 70143031) has the molecular formula C22H25NO2S2
and a molecular weight of 399.58 g/mol. Its IUPAC name is (3R)-1-[3-(6H-benzo[c][1,5]benzodithiepin-6-yl)propyl]piperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | (3R)-1-[3-(6H-benzo[c][1,5]benzodithiepin-6-yl)propyl]piperidine-3-carboxylic acid |
| PubChem CID | 70143031 |
| Molecular Formula | C22H25NO2S2 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | (3R)-1-[3-(6H-benzo[c][1,5]benzodithiepin-6-yl)propyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN(CCCC2Sc3ccccc3Sc3ccccc32)C1 |
| InChI | InChI=1S/C22H25NO2S2/c24-22(25)16-7-5-13-23(15-16)14-6-12-19-17-8-1-2-9-18(17)26-20-10-3-4-11-21(20)27-19/h1-4,8-11,16,19H,5-7,12-15H2,(H,24,25)/t16-,19?/m1/s1 |
| InChIKey | RWDAIUQTADNLLA-VTBWFHPJSA-N |
| XLogP | 5.56 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-1-[3-(6H-benzo[c][1,5]benzodithiepin-6-yl)propyl]piperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-[3-(6H-benzo[c][1,5]benzodithiepin-6-yl)propyl]piperidine-3-carboxylic acid?
The IUPAC name of (3R)-1-[3-(6H-benzo[c][1,5]benzodithiepin-6-yl)propyl]piperidine-3-carboxylic acid (CID 70143031) is (3R)-1-[3-(6H-benzo[c][1,5]benzodithiepin-6-yl)propyl]piperidine-3-carboxylic acid.
What is the SMILES notation for (3R)-1-[3-(6H-benzo[c][1,5]benzodithiepin-6-yl)propyl]piperidine-3-carboxylic acid?
The canonical SMILES for (3R)-1-[3-(6H-benzo[c][1,5]benzodithiepin-6-yl)propyl]piperidine-3-carboxylic acid is O=C(O)[C@@H]1CCCN(CCCC2Sc3ccccc3Sc3ccccc32)C1.
What is the InChIKey of (3R)-1-[3-(6H-benzo[c][1,5]benzodithiepin-6-yl)propyl]piperidine-3-carboxylic acid?
The InChIKey is RWDAIUQTADNLLA-VTBWFHPJSA-N. The full InChI is InChI=1S/C22H25NO2S2/c24-22(25)16-7-5-13-23(15-16)14-6-12-19-17-8-1-2-9-18(17)26-20-10-3-4-11-21(20)27-19/h1-4,8-11,16,19H,5-7,12-15H2,(H,24,25)/t16-,19?/m1/s1.
What are the key properties of (3R)-1-[3-(6H-benzo[c][1,5]benzodithiepin-6-yl)propyl]piperidine-3-carboxylic acid?
(3R)-1-[3-(6H-benzo[c][1,5]benzodithiepin-6-yl)propyl]piperidine-3-carboxylic acid has a molecular weight of 399.58 g/mol, XLogP of 5.56, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-[3-(6H-benzo[c][1,5]benzodithiepin-6-yl)propyl]piperidine-3-carboxylic acid is sourced from PubChem (CID 70143031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).