C17H30O4 — CID 70150863
2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2-(prop-2-enoxymethyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 70150863) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2-(prop-2-enoxymethyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2-(prop-2-enoxymethyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 70150863 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2-(prop-2-enoxymethyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | C=CCOCC1=CC2CCC1C2.CCC(CO)(CO)CO |
| InChI | InChI=1S/C11H16O.C6H14O3/c1-2-5-12-8-11-7-9-3-4-10(11)6-9;1-2-6(3-7,4-8)5-9/h2,7,9-10H,1,3-6,8H2;7-9H,2-5H2,1H3 |
| InChIKey | AYSSHVMEIVJGAC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|