C14H18N4O7S2 — CID 70151670
(1,1-dioxo-2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)methanol;(1,1-dioxo-2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)methyl acetate (PubChem CID 70151670) has the molecular formula C14H18N4O7S2 and a molecular weight of 418.45 g/mol. Its IUPAC name is (1,1-dioxo-2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)methanol;(1,1-dioxo-2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)methyl acetate.
| Compound Name | (1,1-dioxo-2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)methanol;(1,1-dioxo-2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)methyl acetate |
|---|---|
| PubChem CID | 70151670 |
| Molecular Formula | C14H18N4O7S2 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | (1,1-dioxo-2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)methanol;(1,1-dioxo-2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)methyl acetate |
| SMILES | CC(=O)OCc1cn2c(n1)S(=O)(=O)CC2.O=S1(=O)CCn2cc(CO)nc21 |
| InChI | InChI=1S/C8H10N2O4S.C6H8N2O3S/c1-6(11)14-5-7-4-10-2-3-15(12,13)8(10)9-7;9-4-5-3-8-1-2-12(10,11)6(8)7-5/h4H,2-3,5H2,1H3;3,9H,1-2,4H2 |
| InChIKey | PMPNDISSEUYGKH-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 150.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |