C17H18NO3- — CID 7015221
4-[[(E)-2-(5,5-dimethyl-3-oxocyclohexen-1-yl)ethenyl]amino]benzoate (PubChem CID 7015221) has the molecular formula C17H18NO3- and a molecular weight of 284.34 g/mol. Its IUPAC name is 4-[[(E)-2-(5,5-dimethyl-3-oxocyclohexen-1-yl)ethenyl]amino]benzoate.
| Compound Name | 4-[[(E)-2-(5,5-dimethyl-3-oxocyclohexen-1-yl)ethenyl]amino]benzoate |
|---|---|
| PubChem CID | 7015221 |
| Molecular Formula | C17H18NO3- |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 4-[[(E)-2-(5,5-dimethyl-3-oxocyclohexen-1-yl)ethenyl]amino]benzoate |
| SMILES | CC1(C)CC(=O)C=C(/C=C/Nc2ccc(C(=O)[O-])cc2)C1 |
| InChI | InChI=1S/C17H19NO3/c1-17(2)10-12(9-15(19)11-17)7-8-18-14-5-3-13(4-6-14)16(20)21/h3-9,18H,10-11H2,1-2H3,(H,20,21)/p-1/b8-7+ |
| InChIKey | BAIFRGXCNIHTKC-BQYQJAHWSA-M |
| XLogP | 2.29 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |