C15H23N2O2+ — CID 7015615
tert-butyl (3R)-3-phenylpiperazin-4-ium-1-carboxylate (PubChem CID 7015615) has the molecular formula C15H23N2O2+ and a molecular weight of 263.36 g/mol. Its IUPAC name is tert-butyl (3R)-3-phenylpiperazin-4-ium-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-phenylpiperazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 7015615 |
| Molecular Formula | C15H23N2O2+ |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.18 |
| IUPAC Name | tert-butyl (3R)-3-phenylpiperazin-4-ium-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[NH2+][C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C15H22N2O2/c1-15(2,3)19-14(18)17-10-9-16-13(11-17)12-7-5-4-6-8-12/h4-8,13,16H,9-11H2,1-3H3/p+1/t13-/m0/s1 |
| InChIKey | HRRFJZULVYGVNJ-ZDUSSCGKSA-O |
| XLogP | 1.54 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |