C5H8NO4- — CID 7015722
(2S)-2-azaniumyl-2-methylbutanedioate (PubChem CID 7015722) has the molecular formula C5H8NO4- and a molecular weight of 146.12 g/mol. Its IUPAC name is (2S)-2-azaniumyl-2-methylbutanedioate.
| Compound Name | (2S)-2-azaniumyl-2-methylbutanedioate |
|---|---|
| PubChem CID | 7015722 |
| Molecular Formula | C5H8NO4- |
| Molecular Weight | 146.12 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | (2S)-2-azaniumyl-2-methylbutanedioate |
| SMILES | C[C@]([NH3+])(CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C5H9NO4/c1-5(6,4(9)10)2-3(7)8/h2,6H2,1H3,(H,7,8)(H,9,10)/p-1/t5-/m0/s1 |
| InChIKey | CWAYDJFPMMUKOI-YFKPBYRVSA-M |
| XLogP | -4.12 |
| TPSA | 107.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.12 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |