C7H12O5Sr — CID 71479044
strontium;3,3-dimethylpentanedioate;hydrate (PubChem CID 71479044) has the molecular formula C7H12O5Sr and a molecular weight of 263.79 g/mol. Its IUPAC name is strontium;3,3-dimethylpentanedioate;hydrate.
| Compound Name | strontium;3,3-dimethylpentanedioate;hydrate |
|---|---|
| PubChem CID | 71479044 |
| Molecular Formula | C7H12O5Sr |
| Molecular Weight | 263.79 g/mol |
| Exact Mass | 263.97 |
| IUPAC Name | strontium;3,3-dimethylpentanedioate;hydrate |
| SMILES | CC(C)(CC(=O)[O-])CC(=O)[O-].O.[Sr+2] |
| InChI | InChI=1S/C7H12O4.H2O.Sr/c1-7(2,3-5(8)9)4-6(10)11;;/h3-4H2,1-2H3,(H,8,9)(H,10,11);1H2;/q;;+2/p-2 |
| InChIKey | DLJVZQPHYJLRKG-UHFFFAOYSA-L |
| XLogP | -2.91 |
| TPSA | 111.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.79 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |