C20H38BaO4 — CID 164512103
barium(2+);bis(3,3,5,5-tetramethylhexanoate) (PubChem CID 164512103) has the molecular formula C20H38BaO4 and a molecular weight of 479.85 g/mol. Its IUPAC name is barium(2+);bis(3,3,5,5-tetramethylhexanoate).
| Compound Name | barium(2+);bis(3,3,5,5-tetramethylhexanoate) |
|---|---|
| PubChem CID | 164512103 |
| Molecular Formula | C20H38BaO4 |
| Molecular Weight | 479.85 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | barium(2+);bis(3,3,5,5-tetramethylhexanoate) |
| SMILES | CC(C)(C)CC(C)(C)CC(=O)[O-].CC(C)(C)CC(C)(C)CC(=O)[O-].[Ba+2] |
| InChI | InChI=1S/2C10H20O2.Ba/c2*1-9(2,3)7-10(4,5)6-8(11)12;/h2*6-7H2,1-5H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | ROSHGJWNZDDJFF-UHFFFAOYSA-L |
| XLogP | 2.80 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.85 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |